M4223253
DrometrizoleTrisiloxane , analyticalstandard,98% , 155633-54-8
Synonym(s):
2-(2H-Benzotriazol-2-yl)-4-methyl-6-{2-methyl-3-{1,3,3,3-tetramethyl-1-[(trimethylsilyl)oxy]disiloxanyl}propyl}phenol;Silatrizole
CAS NO.:155633-54-8
Empirical Formula: C24H39N3O3Si3
Molecular Weight: 501.85
MDL number: MFCD22373626
EINECS: 422-940-4
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB3549.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-48°C |
| Boiling point: | 530.6±60.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 8.36±0.50(Predicted) |
| form | Solid |
| color | Pale Beige |
| BRN | 11343300 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV FILTER UV ABSORBER |
| InChI | InChI=1S/C24H39N3O3Si3/c1-18-14-20(15-19(2)17-33(9,29-31(3,4)5)30-32(6,7)8)24(28)23(16-18)27-25-21-12-10-11-13-22(21)26-27/h10-14,16,19,28H,15,17H2,1-9H3 |
| InChIKey | HUVYTMDMDZRHBN-UHFFFAOYSA-N |
| SMILES | OC1C(=CC(C)=CC=1N1N=C2C=CC=CC2=N1)CC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| CAS DataBase Reference | 155633-54-8 |
Description and Uses
Drometrizole Trisiloxane is used in the synthesis of UV light absorbers and filters for polyester fibers and suncare formulations.



