M4245153
Neamine , 98% , 3947-65-7
Synonym(s):
2-Deoxy-4-O-(2,6-diamino-2,6-dideoxy-α-D -glucopyranosyl)-D -streptamine
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB644.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225.5°C (rough estimate) |
| Boiling point: | 460.98°C (rough estimate) |
| alpha | D25+112.8° (c = 1) |
| Density | 1.1885 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | Aqueous Acid (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| pka | 13.24±0.70(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1/C12H26N4O6/c13-2-5-8(18)9(19)6(16)12(21-5)22-11-4(15)1-3(14)7(17)10(11)20/h3-12,17-20H,1-2,13-16H2/t3-,4+,5-,6-,7+,8-,9-,10-,11-,12-/s3 |
| InChIKey | SYJXFKPQNSDJLI-CLPOQDAFNA-N |
| SMILES | [C@@H]1(O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O)[C@H](N)[C@@H](O)[C@H](O)[C@@H](CN)O1 |&1:0,2,3,6,8,10,12,14,16,18,r| |
Description and Uses
Neamine is normally found as a core structure of aminoglycoside antibiotics. It is used in the synthesis of disaccharide neamine derivatives as antibacterial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |





