PRODUCT Properties
| Melting point: | 190-191 °C | 
                                    
| Boiling point: | 565.5±50.0 °C(Predicted) | 
                                    
| Density | 1.402±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 4°C, protect from light | 
                                    
| solubility | Chloroform (Slightly), DMSO (Slightly) | 
                                    
| pka | 6.48±0.20(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Off-White to Pale Yellow | 
                                    
| InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)11-8-23-13-7-12(18)17(22-2)16(20)14(13)15(11)19/h3-8,18,20H,1-2H3 | 
                                    
| InChIKey | VOOFPOMXNLNEOF-UHFFFAOYSA-N | 
                                    
| SMILES | C1OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1C1=CC=C(OC)C=C1 | 
                                    
Description and Uses
Irisolidone is a hydrolyzed product of kudzurin. Studies have shown that it can significantly dilate coronary arteries, cerebral arteries and peripheral blood vessels and microvessels, and can reduce vascular resistance, cholesterol and blood viscosity.
Irisolidone has anti-inflammatory, antioxidant, antibacterial, anti-tumor, estrogen-like effects, and protects liver damage caused by alcoholism.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | 







