PRODUCT Properties
| Melting point: | 126-130 °C |
| Boiling point: | 477.9±35.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| solubility | DMSO (Slightly), Methanol |
| form | Solid |
| pka | 6.86±0.23(Predicted) |
| color | Light Orange to Orange |
| Major Application | food and beverages pharmaceutical |
| Cosmetics Ingredients Functions | FRAGRANCE |
| InChI | InChI=1S/C18H14O4/c1-21-18-13(7-8-17-14(18)9-10-22-17)16(20)11-15(19)12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | XTLSKKJNOIMMBK-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C2OC=CC2=C1OC)(=O)CC(C1=CC=CC=C1)=O |
| LogP | 2.676 (est) |
| CAS DataBase Reference | 484-33-3 |
Description and Uses
food and beverages
pharmaceutical
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
