M4264835
Nonylphenol(mixtureofisomers) , 98% , 25154-52-3
CAS NO.:25154-52-3
Empirical Formula: C15H24O
Molecular Weight: 220.35
MDL number: MFCD01778271
EINECS: 246-672-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56.34°C (estimate) |
| Boiling point: | bp 293-297° |
| Density | d420 0.950 |
| vapor density | 7.59 |
| refractive index | nD20 1.513 |
| Flash point: | (open cup) 300°F |
| form | Clear, straw-colored liquid;
technical grade is a mixture of isomers, predominantly
para-substituted |
| color | Clear, straw-colored, viscous liquid |
| Odor | Phenolic; like disinfectant. |
| InChI | InChI=1S/C15H24O/c1-12(2)5-4-6-13(3)11-14-7-9-15(16)10-8-14/h7-10,12-13,16H,4-6,11H2,1-3H3 |
| InChIKey | QFMWIQGYVNZXKN-UHFFFAOYSA-N |
| SMILES | C1=C(CC(CCCC(C)C)C)C=CC(O)=C1 |
| CAS DataBase Reference | 25154-52-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Nonylphenol(25154-52-3) |
| EPA Substance Registry System | Nonylphenol (25154-52-3) |
Description and Uses
Principal use as an intermediate in the production of nonionic ethoxylated surfactants; as an intermediate in the manufacture of phosphite antioxidants used for the plastics and rubber industries
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS08,GHS07,GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H361fd-H302-H410 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501-P273-P391-P501-P264-P270-P301+P312-P330-P501 |
| RIDADR | 3145 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29071310 |
| Hazardous Substances Data | 25154-52-3(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 1620 mg/kg UCDS** 6/9/59 |







