M4289053
(E)-Oct-4-ene-1,8-dioicAcid , 98% , 48059-97-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB252.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-176 °C |
| Boiling point: | 373.1±30.0 °C(Predicted) |
| Density | 1.200±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | 4.27±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-2H,3-6H2,(H,9,10)(H,11,12)/b2-1+ |
| InChIKey | LQVYKEXVMZXOAH-OWOJBTEDSA-N |
| SMILES | C(O)(=O)CC/C=C/CCC(O)=O |
Description and Uses
(E)-Oct-4-ene-1,8-dioic acid is an organic compound that belongs to the group of metathesis reactions. It is a skeleton for many macrocycles and stereoselectivity can be achieved through this reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H412 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 |




