PRODUCT Properties
| Boiling point: | 577.8±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 12.98±0.10(Predicted) |
| color | White to off-white |
| BRN | 2631066 |
| Major Application | clinical testing |
| InChIKey | HFSXHZZDNDGLQN-ZVIOFETBSA-N |
| SMILES | O[C@@H]1[C@H]2[C@H]([C@H]4[C@@]([C@H](CC4)C(=O)CO)(C1)CO)CCC3=CC(=O)CC[C@@]32C |
Description and Uses
18-Hydroxycorticosterone is a derivative of Corticosterone. 18-Hydroxycorticosterone is used as an intermediate in the synthesis of Aldosterone (A514700).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |




