M4401153
5-(p-Methylphenyl)-5-phenylhydantoin , ≥95% , 51169-17-6
Synonym(s):
5-(4-Methylphenyl)-,5-phenylimidazolidine-2,4-dione;5-Phenyl-5-(p-tolyl)hydantoin;MPPH;NSC 32105
CAS NO.:51169-17-6
Empirical Formula: C16H14N2O2
Molecular Weight: 266.29
MDL number: MFCD00005263
EINECS: 257-028-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB416.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-226 °C (lit.) |
| Boiling point: | 409.5°C (rough estimate) |
| Density | 1.1262 (rough estimate) |
| refractive index | 1.6240 (estimate) |
| storage temp. | −20°C |
| solubility | soluble50mg/mL, clear to slightly hazy, colorless to light yellow (DMF:HCl(2:1)) |
| pka | 8.33±0.10(Predicted) |
| form | Powder |
| color | White to off-white |
| InChI | 1S/C16H14N2O2/c1-11-7-9-13(10-8-11)16(12-5-3-2-4-6-12)14(19)17-15(20)18-16/h2-10H,1H3,(H2,17,18,19,20) |
| InChIKey | WPAPSGQWYNPWCZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)C2(NC(=O)NC2=O)c3ccccc3 |
Description and Uses
Reactant for synthesis of N-chlorohydantoins1
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351-H361 |
| Precautionary statements | P281 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 22-40-63 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29332100 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Repr. 2 |







