M4426053
Epoxiconazole , analyticalstandard , 133855-98-8
CAS NO.：133855-98-8
Empirical Formula: C17H13ClFN3O
Molecular Weight: 329.76
MDL number: MFCD01311796
EINECS: 603-768-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB555.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 463.1±55.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 2.75±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | 8.42mg/L at 20℃ |
| BRN | 9509539 |
| InChI | 1S/C17H13ClFN3O/c18-15-4-2-1-3-14(15)16-17(23-16,9-22-11-20-10-21-22)12-5-7-13(19)8-6-12/h1-8,10-11,16H,9H2/t16-,17+/m0/s1 |
| InChIKey | ZMYFCFLJBGAQRS-DLBZAZTESA-N |
| SMILES | Fc1ccc(cc1)[C@@]3(Cn2cncn2)O[C@@H]3c4ccccc4Cl |
| LogP | 3.33 at 25℃ |
| EPA Substance Registry System | Epoxiconazole (133855-98-8) |
Description and Uses
1-[[(2S,3S)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole is a fungicide used to inhibit the metabolism and growth of mycelia.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H351-H360FD-H411 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| Hazard Codes | Xn,N,T |
| Risk Statements | 40-51/53-62-63-61 |
| Safety Statements | 36/37-46-61-45-53 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | XZ4500100 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Carc. 2 Repr. 1B |
