M4446753
Isoxaben , 98% , 82558-50-7
CAS NO.：82558-50-7
Empirical Formula: C18H24N2O4
Molecular Weight: 332.39
MDL number: MFCD00072433
EINECS: 407-190-8
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB252.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-179 °C |
| Boiling point: | 469.52°C (rough estimate) |
| Density | 1.2149 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 0-6°C |
| pka | 11.44±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | agriculture environmental |
| InChI | 1S/C18H24N2O4/c1-6-18(3,7-2)14-11-15(24-20-14)19-17(21)16-12(22-4)9-8-10-13(16)23-5/h8-11H,6-7H2,1-5H3,(H,19,21) |
| InChIKey | PMHURSZHKKJGBM-UHFFFAOYSA-N |
| SMILES | CCC(C)(CC)c1cc(NC(=O)c2c(OC)cccc2OC)on1 |
| EPA Substance Registry System | Isoxaben (82558-50-7) |
Description and Uses
Isoxaben is a herbicide residue in tea and other plants. A cellulose biosynthesis inhibitor in plants.
Safety
| Hazard statements | H413 |
| Precautionary statements | P273-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 53-40 |
| Safety Statements | 61-36 |
| WGK Germany | 3 |
| RTECS | CV4370300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 82558-50-7(Hazardous Substances Data) |
