PRODUCT Properties
| Melting point: | 170-172℃ (ethanol ) |
| Boiling point: | 384.01°C (rough estimate) |
| Density | 1.2009 (rough estimate) |
| refractive index | 1.5780 (estimate) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.52±0.36(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C14H11NO3/c16-13(15-10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(17)18/h1-9H,(H,15,16)(H,17,18) |
| InChIKey | DSUPUOGOCIFZBG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1C(NC1=CC=CC=C1)=O |
Description and Uses
Phthalanilic acid is a compound that is useful in the production of fertilizers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |







