M4477035
NSC702827 , 99% , 252916-29-3
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB202.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252-254 °C |
| Boiling point: | 590.5±50.0 °C(Predicted) |
| Density | 1.328±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4+-.0.10(Predicted) |
| color | Orange to Brown |
| InChI | InChI=1S/C18H18N2O3/c1-10-12(7-8-17(21)22)11(2)19-16(10)9-14-13-5-3-4-6-15(13)20-18(14)23/h3-6,9,19H,7-8H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | NHFDRBXTEDBWCZ-UHFFFAOYSA-N |
| SMILES | N1C(C=C2C3=C(NC2=O)C=CC=C3)=C(C)C(CCC(O)=O)=C1C |
Description and Uses
TSU-68 is a inhibitor that targets vascular endothelial growth factor receptor 2, platelet-derived growth factor receptor β, and fibroblast growth factor receptor 1. The inhibitory effects of TSU-68 towards these growth factors lead to substantial antitumor activity and showed potential in its development in therapeutic uses.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H318-H361-H372 |
| Precautionary statements | P201-P202-P260-P264-P270-P280-P301+P310-P321-P330-P305+P351+P338-P308+P313-P314-P405-P501 |
