M4483035
N-DesethylSunitinib , 97% , 356068-97-8
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB742.40 | In Stock |
|
| 5mg | RMB2291.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 268-270C |
| Boiling point: | 574.4±50.0 °C(Predicted) |
| Density | 1.265±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly, Heated), Methanol (Sparingly) |
| pka | 11.71±0.20(Predicted) |
| form | Solid |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C20H23FN4O2/c1-4-22-7-8-23-20(27)18-11(2)17(24-12(18)3)10-15-14-9-13(21)5-6-16(14)25-19(15)26/h5-6,9-10,22,24H,4,7-8H2,1-3H3,(H,23,27)(H,25,26)/b15-10- |
| InChIKey | LIZNIAKSBJKPQC-GDNBJRDFSA-N |
| SMILES | N1C(/C=C2/C3=C(NC/2=O)C=CC(F)=C3)=C(C)C(C(NCCNCC)=O)=C1C |
Description and Uses
A metabolite of Sunitinib (S820000).
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H361d-H373-H410 |
| Precautionary statements | P202-P260-P273-P280-P308+P313-P391 |
| target organs | blood vessel,Bone marrow |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 STOT RE 2 |








