M4494953
Tetrakis(diethylamino)zirconium , 99% , 13801-49-5
Synonym(s):
Tetrakis(diethylamido)zirconium;Tetrakis(diethylamino)zirconium;Zirconium tetrakis(diethylamide)
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 128 °C/0.05 mmHg (lit.) |
| Density | 1.026 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 54 °F |
| storage temp. | 2-8°C |
| form | liquid |
| color | yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/4C4H10N.Zr/c4*1-3-5-4-2;/h4*3-4H2,1-2H3;/q4*-1;+4 |
| InChIKey | GOVWJRDDHRBJRW-UHFFFAOYSA-N |
| SMILES | CCN(CC)[Zr](N(CC)CC)(N(CC)CC)N(CC)CC |
Description and Uses
Tetrakis(diethylamino)zirconium is used in the preparation of ZrN and ZrO2 films as well as zirconium complexes to act as catalytic precursors for organic chemical reactions.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H261-H315-H319-H335 |
| Precautionary statements | P210-P231+P232-P261-P305+P351+P338-P422 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-14-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 3398 4.3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 4.3 |
| PackingGroup | II |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 Water-react 2 |
