M4504135
N-Feruloyltyramine , 97% , 66648-43-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1504.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) |
| Boiling point: | 603.3±55.0 °C(Predicted) |
| Density | 1.248±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO and methan |
| form | powder |
| pka | 9.83±0.31(Predicted) |
| color | White |
| InChI | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
| InChIKey | NPNNKDMSXVRADT-WEVVVXLNSA-N |
| SMILES | C(NCCC1=CC=C(O)C=C1)(=O)/C=C/C1=CC=C(O)C(OC)=C1 |
Description and Uses
Alfrutamide is a phenolic amides found in garlic and cocoa. Alfrutamide inhibits cyclooxygenases 1 and 2.
