M4525853
R-(?)-Fluoxetinehydrochloride , 98% , 114247-09-5
Synonym(s):
(R)-N-Methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propylamine hydrochloride
CAS NO.:114247-09-5
Empirical Formula: C17H19ClF3NO
Molecular Weight: 345.79
MDL number: MFCD04040065
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB888.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129°C |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | H2O: 20 mg/mL, soluble |
| form | solid |
| color | white |
| Water Solubility | H2O: soluble >10mg/mL |
| InChI | 1S/C17H18F3NO.ClH/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20;/h2-10,16,21H,11-12H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | GIYXAJPCNFJEHY-PKLMIRHRSA-N |
| SMILES | Cl[H].CNCC[C@@H](Oc1ccc(cc1)C(F)(F)F)c2ccccc2 |
| CAS DataBase Reference | 114247-09-5(CAS DataBase Reference) |
Description and Uses
As a selective serotonin reuptake inhibitor (SSRI), R-(-)-Fluoxetine hydrochloride can be used as an antidepressant.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |




