M4642353
5β-Pregnan-3α-ol-20-one , 98% , 128-20-1
Synonym(s):
3α-Hydroxy-5β-pregnan-20-one;3α-Hydroxy-5β-tetrahydroprogesterone;Pregnanolone
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149°C |
| alpha | D23 +59.6° (c = 0.3 in chloroform); D26 +108.5 ±1° (c = 9.23 mg/1.23 ml abs ethanol) |
| Boiling point: | 397.64°C (rough estimate) |
| Density | 1.0234 (rough estimate) |
| refractive index | 1.5344 (estimate) |
| storage temp. | Store at RT |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 15.12±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic (organic) |
| Water Solubility | 8mg/L(room temperature) |
| InChI | 1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3 |
| InChIKey | AURFZBICLPNKBZ-UHFFFAOYSA-N |
| SMILES | [H]C12CCC3C4CCC(C(C)=O)C4(C)CCC3C1(C)CC[C@H](O)C2 |
| NIST Chemistry Reference | 3Alpha-hydroxy-5beta-pregnan-20-one(128-20-1) |
Description and Uses
A hyponotic-anaesthetic agent.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P281 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| RTECS | TU4384000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
| Toxicity | LD50 in mice, rats (mg/kg): 66 ± 10, 27.5 ± 2.4 i.v. (Gyermek) |
