M4679153
Endrin-ketone , 97% , 53494-70-5
Synonym(s):
3b,4,5,6,6,6a-Hexachlorodecahydro-2,5,7-metheno-3H-cyclopenta[a]pentalen-3-one
CAS NO.:53494-70-5
Empirical Formula: C12H8Cl6O
Molecular Weight: 380.91
MDL number: MFCD00152482
EINECS: 625-032-8
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB4000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 496.11°C (rough estimate) |
| Density | 1.5674 (rough estimate) |
| refractive index | 1.5550 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly, Sonicated), Ethyl Acetate (Slightly) |
| Major Application | agriculture |
| InChI | 1S/C12H8Cl6O/c13-8-9(14)6-2-1-3(7(6)19)4-5(2)11(9,16)12(17,18)10(4,8)15/h2-6,8H,1H2/t2-,3+,4+,5-,6+,8+,9-,10+,11-/m1/s1 |
| InChIKey | IZHZFAQWVKBTSL-YTMKBKNTSA-N |
| SMILES | Cl[C@@H]1[C@@]2(Cl)[C@H]3[C@@H]4C[C@@H]5[C@H]3[C@](Cl)(C2(Cl)Cl)[C@@]1(Cl)[C@@H]5C4=O |
| EPA Substance Registry System | Endrin ketone (53494-70-5) |
Description and Uses
-Ketoendrin is an isomerization product of Endrin (E555530), a chlorinated hydrocarbon insecticide that produces hepatic and neurologic toxicity. Endrin is also known to produce hyperexcitability of the human central nervous system that could result in convulsions. -Ketoendrin is an endocrine disrupting compound that has been found in human fetal and newborn tissues.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,T+ |
| Risk Statements | 11-20/21/22-36-28 |
| Safety Statements | 16-26-36-45-36/37-28 |
| RIDADR | 2761 |
| WGK Germany | 2 |
| RTECS | PC8600000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |







