M4686953
3-Methyladamantan-1-aminehydrochloride , 95% , 33103-93-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB4536.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 297-300°C |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Sparingly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | 1S/C11H19N.ClH/c1-10-3-8-2-9(4-10)6-11(12,5-8)7-10;/h8-9H,2-7,12H2,1H3;1H |
| InChIKey | WITBNCXKULHPMW-UHFFFAOYSA-N |
| SMILES | Cl.NC21CC3(CC(C2)CC(C1)C3)C |
Description and Uses
Demethyl Memantine Hydrochloride is an analogue of Adamantane used as medicinal agent.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H227 |
| Precautionary statements | P501-P261-P270-P210-P271-P264-P280-P370+P378-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P403+P235-P405 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2921300000 |
| Storage Class | 11 - Combustible Solids |
