M4689653
DesmethylPyrovaleroneHydrochlorideSalt , 98% , 5485-65-4
CAS NO.：5485-65-4
Empirical Formula: C15H22ClNO
Molecular Weight: 267.794
MDL number: MFCD28100858
EINECS: 200-659-6
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162 °C(Solv: acetone (67-64-1)) |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| form | liquid |
| Major Application | forensics and toxicology |
| InChI | 1S/C15H21NO.ClH/c1-2-8-14(16-11-6-7-12-16)15(17)13-9-4-3-5-10-13;/h3-5,9-10,14H,2,6-8,11-12H2,1H3;1H |
| InChIKey | ROMXVSMENBAYRM-UHFFFAOYSA-N |
| SMILES | O=C(C1=CC=CC=C1)C(CCC)N2CCCC2.Cl |
Description and Uses
α-Pyrrolidinovalerophenone (PVP) is a stimulant compound developed in the 1960s and related to Pyrovalerone (P99775), which has been reported as a novel designer drug.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
