M4706153
(E)-Guggulsterone , 98% , 39025-24-6
Synonym(s):
(17E)-Pregna-4,17(20)-diene-3,16-dione
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1036.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-171.5° |
| alpha | D26 -30° (c = 1 in chloroform) |
| Boiling point: | 463℃ |
| Density | 1.10 |
| Flash point: | 172℃ |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble5mg/mL |
| form | powder |
| color | white to off-white |
| InChI | InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4-/t15-,17+,18+,20+,21-/m1/s1 |
| InChIKey | WDXRGPWQVHZTQJ-AUKWTSKRSA-N |
| SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)/C(=C\C)/C(=O)C3)CC2 |
| LogP | 3.650 (est) |
Description and Uses
(E)-Guggulsterone acts as an α-glucosidase inhibitor also known as a hypolipidemic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H412 |
| Precautionary statements | P261-P271-P273-P304+P340+P312-P403+P233-P405 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 37-52/53 |
| Safety Statements | 61-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 STOT SE 3 |
