PRODUCT Properties
| Melting point: | 104-105° |
| alpha | D20 +50° (in dioxane) |
| Boiling point: | 565.8±50.0 °C(Predicted) |
| Density | 1.253±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| form | Solid |
| pka | 15.05±0.40(Predicted) |
| color | White to off-white |
| Water Solubility | 1mg/L(30 ºC) |
| InChIKey | FRPJXPJMRWBBIH-SZZXFXARNA-N |
| SMILES | [C@@]12([H])CCC3C=C(OC(=O)N(CCCl)CCCl)C=CC=3[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])O |&1:0,20,24,26,29,r| |
| CAS DataBase Reference | 2998-57-4(CAS DataBase Reference) |
Description and Uses
Estradiol 3-[N,N-Bis(2-chloroethyl)carbamate] is used treatment of breast cancer. Also used in the treatment of prostate cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
