M4747253
Cefmetazole , 98% , 56796-20-4
CAS NO.：56796-20-4
Empirical Formula: C15H17N7O5S3
Molecular Weight: 471.53
MDL number: MFCD00865068
EINECS: 260-384-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB476.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-165?C |
| Density | 1.4380 (rough estimate) |
| refractive index | 1.7400 (estimate) |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly, Heated) |
| form | Solid |
| pka | 2.65±0.50(Predicted) |
| color | White |
| Water Solubility | Soluble in water |
| InChIKey | SNBUBQHDYVFSQF-HIFRSBDPSA-N |
| SMILES | N12[C@@]([H])([C@@](NC(CSCC#N)=O)(OC)C1=O)SCC(CSC1N(C)N=NN=1)=C2C(O)=O |
| CAS DataBase Reference | 56796-20-4(CAS DataBase Reference) |
Description and Uses
Cefmetazole is a cephamycin with a nonaromatic side chain at C-7. In addition to a fairly characteristic second-generation cephalosporin antimicrobial spectrum, it possess fairly significant anti-antiaerobic activity. The ejection of its C-3 side chain leads to alcohol intolerance of the disulfuram type and prolonged clotting times.
A broad spectrum second generation cephalosporin antibiotic
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P280a-P284-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | XI0372200 |
| HS Code | 2941906000 |
