M4759053
HPF(solution) , 98% , 359010-69-8
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB4814.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 674.7±55.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C, protect from light |
| solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:8): .15 mg/ml |
| form | Pale yellow. |
| pka | 9.58±0.20(Predicted) |
| color | Colorless to light yellow |
| InChI | InChI=1S/C26H16O6/c27-15-5-8-17(9-6-15)30-18-10-12-22-24(14-18)31-23-13-16(28)7-11-21(23)26(22)20-4-2-1-3-19(20)25(29)32-26/h1-14,27-28H |
| InChIKey | NPOSMYDPUKBGQL-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=C(OC4=CC=C(O)C=C4)C=C3)OC3=C1C=CC(O)=C3)C1=C(C=CC=C1)C(=O)O2 |
Description and Uses
ROS Probe, HPF is a cell-permeable, photo-stable hydroxyphenyl-substituted fluorescein compound.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |