PRODUCT Properties
| Boiling point: | 150-208 °C |
| Density | 1.083 g/mL at 25 °C |
| refractive index | n20/D 1.575 |
| Flash point: | 47 °C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Oil |
| color | Clear Colourless |
| Odor | at 0.10 % in propylene glycol. garlic |
| Odor Type | garlic |
| InChI | InChI=1S/C6H10S3/c1-2-3-4-5(7)6(8)9/h2,7-9H,1,3-4H2 |
| InChIKey | XGYVEKBQAPYNLL-UHFFFAOYSA-N |
| SMILES | C(/S)(\S)=C(/S)\CCC=C |
| EPA Substance Registry System | Garlic, ext. (8008-99-9) |
Description and Uses
garlic oil is considered a healing oil with bacteriostatic and bactericidal action. It is incorporated into skin care formulations for skin healing and to aid in clearing problems such as eczema and acne.
Safety
| Symbol(GHS) |   GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H319-H226-H315-H301-H317 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P264-P280-P302+P352-P321-P332+P313-P362-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xn |
| Risk Statements | 10-22 |
| Safety Statements | 16-36 |
| RIDADR | UN 1993 3/PG 3 |
| RTECS | LX3154800 |
