M4821135
Poly[[6-[(1,1,3,3-tetramethylbutyl)amino]-s-triazine-2,4-diyl]-[(2,2,6,6-tetramethyl-4-piperidyl)imino]-hexamethylene-[(2,2,6,6-tetramethyl-4-piperidyl)imino] , 98% , 71878-19-8
CAS NO.:71878-19-8
Empirical Formula: C35H69Cl3N8
Molecular Weight: 708.335
MDL number: MFCD16294566
EINECS: 615-678-9
| Pack Size | Price | Stock | Quantity |
| 100g | RMB121.60 | In Stock |
|
| 500g | RMB416.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C(lit.) |
| λmax | 240 nm |
| InChIKey | ORECYURYFJYPKY-UHFFFAOYSA-N |
| SMILES | N1=C(Cl)N=C(N=C1Cl)Cl.N1C(C)(C)CC(CC1(C)C)NCCCCCCNC1CC(C)(C)NC(C)(C)C1.C(C)(C)(N)CC(C)(C)C |
| CAS DataBase Reference | 71878-19-8(CAS DataBase Reference) |
| EPA Substance Registry System | Poly[[6-[(1,1,3,3-tetramethylbutyl)amino]-1,3,5-triazine-2,4-diyl][(2,2,6,6-tetramethyl-4-piperidinyl)imino]-1,6-hexanediyl[(2,2,6,6-tetramethyl-4-piperidinyl)imino]] (71878-19-8) |
Description and Uses
Hindered amine UV light stabilizer for polyolefins.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H319-H330-H335 |
| Precautionary statements | P260-P264-P271-P280-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | T+ |
| Risk Statements | 26-36/37 |
| Safety Statements | 26-36/37-45-28 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TR7755000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Eye Irrit. 2 STOT SE 3 |

![Poly[[6-[(1,1,3,3-tetramethylbutyl)amino]-s-triazine-2,4-diyl]-[(2,2,6,6-tetramethyl-4-piperidyl)imino]-hexamethylene-[(2,2,6,6-tetramethyl-4-piperidyl)imino]](https://img.chemicalbook.com/CAS/20180713/GIF/71878-19-8.gif)




![Nickel bis[monoethyl(3,5-di-tert-butyl-4-hydroxylbenzyl)phosphonate]](https://img.chemicalbook.com/CAS/GIF/30947-30-9.gif)
