M4911335
PPQ-102 , >98% , 931706-15-9
Synonym(s):
;CFTR Inhibitor IV, PPQ-102 - CAS 931706-15-9 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB608.00 | In Stock |
|
| 10mg | RMB1056.00 | In Stock |
|
| 25mg | RMB2208.00 | In Stock |
|
| 100mg | RMB6560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300℃ (ethanol ) |
| Boiling point: | 648.7±65.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | -20C |
| solubility | DMF: 0.2 mg/ml |
| form | White crystalline solid |
| pka | 1.00±0.40(Predicted) |
| color | Light yellow to yellow |
| InChI | 1S/C26H22N4O3/c1-15-13-14-19(33-15)21-24-23-20(25(31)29(3)26(32)28(23)2)22(16-9-5-4-6-10-16)30(24)18-12-8-7-11-17(18)27-21/h4-14,21,27H,1-3H3 |
| InChIKey | MNOOVRNGPIWJDI-UHFFFAOYSA-N |
| SMILES | [n]21c(c5[n]([c]([n]([c](c5c2c6ccccc6)=O)C)=O)C)C(Nc4c1cccc4)c3[o]c(cc3)C |
Description and Uses
PPQ-102 (CFTR Inhibitor) is a reversible CFTR inhibitor that completely inhibits CFTR chloride currents (IC50 ~90 nM). PPQ-102 is not affected by membrane potential-dependent cell allocation or blocking efficiency (uncharged at physiological pH) and effectively prevents cyst enlargement in polycystic kidney disease[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







