PRODUCT Properties
| Boiling point: | 186℃ |
| Density | 0.913±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.47053 (589.3 nm, 21℃) |
| Flash point: | 55.9±5.6℃ |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml; Ethanol: 10 mg/ml |
| form | Oil |
| color | Colourless |
| Odor | at 100.00?%. woody |
| Stability: | Volatile |
| InChI | InChI=1S/C10H14O/c1-9(2)4-3-5-10-6-7-11-8-10/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | XNGKCOFXDHYSGR-UHFFFAOYSA-N |
| SMILES | O1C=CC(CC/C=C(\C)/C)=C1 |
| LogP | 3.773 (est) |
Description and Uses
Perillene is a component of the essential oil, has antibacterial and antitumor effects[1].
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H312+H332-H319 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P261-P264-P271-P280-P303+P361+P353-P304+P340-P305+P351+P338-P312-P321-P362+P364-P337+P313-P370+P378-P403+P235-P501 |
