PRODUCT Properties
| Melting point: | 148-151 °C |
| Boiling point: | 160°C |
| Density | 1.001 |
| vapor density | 3.79 (vs air) |
| vapor pressure | 760 mmHg ( 160 °C) |
| refractive index | 1.578 |
| Flash point: | -20°F |
| storage temp. | -20°C |
| form | liquid |
| color | colorless |
| Water Solubility | Insoluble in water. |
| Sensitive | Air & Moisture Sensitive |
| BRN | 741946 |
| Exposure limits | ACGIH: Ceiling 0.05 ppm NIOSH: Ceiling 0.05 ppm(0.25 mg/m3) |
| InChIKey | RPGWZZNNEUHDAQ-UHFFFAOYSA-N |
| CAS DataBase Reference | 638-21-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenylphosphine(638-21-1) |
| EPA Substance Registry System | Phenylphosphine (638-21-1) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H302-H304-H315-H319-H336-H361f-H411 |
| Precautionary statements | P210-P273-P301+P310-P303+P361+P353-P305+P351+P338-P331 |
| Hazard Codes | F;T;N,N,T,F,Xn |
| Risk Statements | 11-17-23/24/25-36/37/38-48/20-51/53-62-65-67-38-20/21/22 |
| Safety Statements | 16-26-36/37/39-45-62-61-36/37 |
| RIDADR | 2924 |
| OEL | Ceiling: 0.05 ppm (0.25 mg/m3) |
| WGK Germany | 3 |
| RTECS | SZ2100000 |
| HazardClass | 4.2 |
| PackingGroup | I |
| Hazardous Substances Data | 638-21-1(Hazardous Substances Data) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (300g or 300ml) |








