PRODUCT Properties
| Melting point: | 106-110° (with decompn) |
| Density | 1.255-1.256 |
| storage temp. | Refrigerator |
| solubility | Slightly soluble in water, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | WHRVRSCEWKLAHX-RLWRCNEPNA-N |
| SMILES | C(C1C=CC(N)=CC=1)(=O)OCCN(CC)CC.C([C@H]1C(S[C@]2([H])[C@H](NC(=O)CC3C=CC=CC=3)C(=O)N12)(C)C)(=O)O |&1:18,21,23,r| |
| CAS DataBase Reference | 6130-64-9(CAS DataBase Reference) |
Description and Uses
Benzylpenicillin procaine was developed as a dilatorily acting benzylpenicillin, only slightly soluble in water. It has been used with peanut oil or carboxymethylcellulose as an oil suspension or an aqueous suspension, respectively .
Procaine penicilline G hydrate is a composed of the β-lactam antibiotic of Penicillin G and the sodium channel blocker Procaine. As an antibiotic, Penicillin G is noted to posses effectiveness mainly against gram-positive organisms. Procaine Penicillin G is used a growth stimulant for poultry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 36 |
| WGK Germany | WGK 1 |
| RTECS | XH9450000 |
| HS Code | 2941102000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Toxicity | LD50 s.c. in mice: 2.3 g/kg (Soehring) |





