M5000735
PhthalicAcidAnhydride-d4 , BR , 75935-32-9
Synonym(s):
1,3-Isobenzofurandione-4,5,6,7-d4
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB649.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-134 °C (lit.) |
| Boiling point: | 284 °C (lit.) |
| storage temp. | Refrigerator, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Moisture Sensitive |
| InChI | 1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H/i1D,2D,3D,4D |
| InChIKey | LGRFSURHDFAFJT-RHQRLBAQSA-N |
| SMILES | [2H]c1c([2H])c([2H])c2C(=O)OC(=O)c2c1[2H] |
| CAS Number Unlabeled | 85-44-9 |
Description and Uses
Labelled analogue of Phthalic Acid Anhydride, an organic reagent used to synthesize phthalates.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-42/43-41-37/38 |
| Safety Statements | 26-36-46-37/39-24/25-23 |
| RIDADR | UN 2214 8/PG 3 |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
