M5013035
Polyaniline , 98%, this recruitment state , 5612-44-2
Synonym(s):
Emeraldine base polyaniline;PANI
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB134.40 | In Stock |
|
| 25g | RMB308.80 | In Stock |
|
| 100g | RMB797.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >350 °C |
| Boiling point: | <82 °C |
| Density | 0.804 g/mL at 25 °C |
| bulk density | 18.8lb/cu.ft |
| Flash point: | 12 °C |
| storage temp. | 2-8°C, protect from light |
| solubility | m-cresol: soluble |
| form | powder (Infusible) |
| pka | 5.68±0.10(Predicted) |
| Appearance | Brown to black Solid |
| Water Solubility | H2O: insoluble organic solvents: insoluble |
| InChIKey | UBOHYACRFJAUIB-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(NC3=CC=C(N)C=C3)C=C2)=CC=C(NC2=CC=C(N=C3C=CC(=NC4=CC=C(N=C5C=CC(=NC6=CC=CC=C6)C=C5)C=C4)C=C3)C=C2)C=C1 |
Description and Uses
PANI-EB finds its usage in a variety of applications which include chemical sensors, absorptive micro-extraction, anticorrosive layer and microelectromechanical systems.
Safety
| Hazard Codes | F,Xi,Xn |
| Risk Statements | 11-36-67-37-36/37/38-20/21-10 |
| Safety Statements | 16-26-36-22-36/37/39 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 10 |



