M5070848
emodin1-O-β-D-glucopyranoside , 98% , 38840-23-2
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1600.00 | In Stock |
|
| 20mg | RMB2080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-241℃ |
| Boiling point: | 834.5±65.0 °C(Predicted) |
| Density | 1.667±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 6.45±0.20(Predicted) |
| form | Solid |
| color | Yellow to Dark Yellow |
| Stability: | Hygroscopic |
| InChIKey | ZXXFEBMBNPRRSI-FMQABLMVNA-N |
| SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C(O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)=CC(C)=C3)=CC(O)=C1 |&1:12,13,15,17,19,r| |
Description and Uses
Emodin 1-β-D-Glucoside is an impurity formed in the synthesis of glucoside metabolites of Emodin (E523000).



