M5107048
β-Pinene , 95% , 2437-95-8
CAS NO.:2437-95-8
Empirical Formula: C10H16
Molecular Weight: 136.23
MDL number: MFCD00001339
EINECS: 219-445-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB790.40 | In Stock |
|
| 5g | RMB2356.80 | In Stock |
|
| 25g | RMB7040.00 | In Stock |
|
| 100g | RMB18400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -55 °C |
| Boiling point: | 155-156 °C(lit.) |
| Density | 0.858 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 90 °F |
| Dielectric constant | 2.6(25℃) |
| InChI | InChI=1/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/s3 |
| InChIKey | GRWFGVWFFZKLTI-JQEWEITDNA-N |
| SMILES | [C@@]12([H])C(C)=CC[C@@]([H])(C1)C2(C)C |&1:0,6,r| |
| CAS DataBase Reference | 2437-95-8(CAS DataBase Reference) |
Description and Uses
β-Pinene is also used in flavor compositions, partly as ingredient in artificial Lemon and Nutmeg oils, partly as component of such type flavors. The concentration in the finished product will be about 15 to 150 ppm. alpha-Pinene has a more balsamic taste, while be~a-Pinene, less suitable for flavors, has a dry-woody character.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi,N |
| Risk Statements | 10-36/37/38-43-50 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 2368 3/PG 3 |
| WGK Germany | 1 |
| RTECS | DT7000000 |
| HS Code | 29021910 |





