M5128348
4,5-Methylenedioxy-1,2-phenylenediaminedihydrochloride , Fluorescent reagents, ≥95%(HPLC) , 81864-15-5
Synonym(s):
1,2-Diamino-4,5-methylenedioxybenzene dihydrochloride;1,3-Benzodioxole-5,6-diamine dihydrochloride;5,6-Diamino-1,3-benzodioxole dihydrochloride;MDB
CAS NO.：81864-15-5
Empirical Formula: C7H10Cl2N2O2
Molecular Weight: 225.07
MDL number: MFCD00037497
| Pack Size | Price | Stock | Quantity |
| 2mg | RMB319.20 | In Stock |
|
| 10mg | RMB934.40 | In Stock |
|
| 50mg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-249 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | Light Brown |
| Water Solubility | H2O: 50mg/mL |
| BRN | 5641607 |
| Stability: | Light Sensitive |
| InChI | 1S/C7H8N2O2.2ClH/c8-4-1-6-7(2-5(4)9)11-3-10-6;;/h1-2H,3,8-9H2;2*1H |
| InChIKey | YXEJRYIEFFUUID-UHFFFAOYSA-N |
| SMILES | Cl[H].Cl[H].Nc1cc2OCOc2cc1N |
| CAS DataBase Reference | 81864-15-5 |
Description and Uses
A highly sensitive reagent for α-keto acids. A fluorometric labeling reagent. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-23 |
| Hazard Note | Irritant |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
