M5193635
R-(-)-5-(2-Aminopropyl)-2-methoxybenzenesulfonamide , 95% , 112101-81-2
CAS NO.：112101-81-2
Empirical Formula: C10H16N2O3S
Molecular Weight: 244.31
MDL number: MFCD08704365
EINECS: 601-159-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.80 | In Stock |
|
| 1g | RMB262.40 | In Stock |
|
| 5g | RMB1060.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-167 °C |
| Boiling point: | 445.5±55.0 °C(Predicted) |
| Density | 1.247±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.08±0.60(Predicted) |
| color | White |
| InChI | InChI=1S/C10H16N2O3S/c1-7(11)5-8-3-4-9(15-2)10(6-8)16(12,13)14/h3-4,6-7H,5,11H2,1-2H3,(H2,12,13,14)/t7-/m1/s1 |
| InChIKey | IORITYIZDHJCGT-SSDOTTSWSA-N |
| SMILES | C1(S(N)(=O)=O)=CC(C[C@H](N)C)=CC=C1OC |
| CAS DataBase Reference | 112101-81-2(CAS DataBase Reference) |
Description and Uses
Precursor in the synthesis of Tamsulosin (T006350) and other alpha-andregenic antagonists. (R)-Tamsulosin is a specific a1-adrenoceptor antagonist. It is used in the treatment of benign prostatic hypertrophy.
Safety
| Symbol(GHS) |    GHS07,GHS09,GHS05 |
| Signal word | Danger |
| Hazard statements | H411-H318-H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P280-P305+P351+P338-P310 |
