M5277735
Rhamnetin , 97% , 90-19-7
Synonym(s):
β-Rhamnocitrin;3,3′,4′,5-Tetrahydroxy 7-methoxyflavone;7-Methoxyquercetin;7-Methylquercetin;Quercetin 7-methyl ether
CAS NO.:90-19-7
Empirical Formula: C16H12O7
Molecular Weight: 316.26
MDL number: MFCD00016931
EINECS: 201-974-1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293-296°C (dec.) |
| Boiling point: | 375.7°C (rough estimate) |
| Density | 1.3347 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 6.15±0.40(Predicted) |
| form | Solid |
| color | Light Yellow to Dark Yellow |
| BRN | 47741 |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChI | 1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
| InChIKey | JGUZGNYPMHHYRK-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2C(=O)C(O)=C(Oc2c1)c3ccc(O)c(O)c3 |
| LogP | 2.580 (est) |
| CAS DataBase Reference | 90-19-7(CAS DataBase Reference) |
Description and Uses
O-Methylated metabolite of the flavanoid Quercertin (Q509500) with antioxidant activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | LK8748000 |
| F | 3-10 |
| Storage Class | 11 - Combustible Solids |




