PRODUCT Properties
| Melting point: | 125-126°C |
| Boiling point: | 648.96°C (rough estimate) |
| Density | 1.4371 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 9.95±0.10(Predicted) |
| color | Off-white to yellow |
| optical activity | +88.318 (c 0.21, ethanol) |
| InChI | InChI=1S/C19H23NO4/c1-20-7-6-13-10-19(24-3)17(22)11-14(13)15(20)8-12-4-5-18(23-2)16(21)9-12/h4-5,9-11,15,21-22H,6-8H2,1-3H3/t15-/m0/s1 |
| InChIKey | BHLYRWXGMIUIHG-HNNXBMFYSA-N |
| SMILES | [C@H]1(CC2=CC=C(OC)C(O)=C2)C2=C(C=C(OC)C(O)=C2)CCN1C |
Description and Uses
Precursor of many aporphine and morphine-type alkaloids.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P405 |






![6,7,12b,13-Tetrahydro-4H-[1,3]dioxolo[4',5':7,8]isoquinolino[3,2-a][1,3]dioxolo[4,5-g]isoquinoline](https://img.chemicalbook.com/CAS/GIF/4312-32-7.gif)
