M5403447
2-[(3-iodo-2H-indazol-6-yl)sulfanyl]-N-methylbenzamide , ≥95% , 885126-34-1
CAS NO.:885126-34-1
Empirical Formula: C15H12IN3OS
Molecular Weight: 409.24
MDL number: MFCD13183042
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1200.00 | In Stock |
|
| 5g | RMB3900.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 613.9±45.0 °C(Predicted) |
| Density | 1.80±0.1 g/cm3(Predicted) |
| pka | 11.06±0.40(Predicted) |
| InChI | InChI=1S/C15H12IN3OS/c1-17-15(20)11-4-2-3-5-13(11)21-9-6-7-10-12(8-9)18-19-14(10)16/h2-8H,1H3,(H,17,20)(H,18,19) |
| InChIKey | VHZLHFNNNDGPLF-UHFFFAOYSA-N |
| SMILES | C(NC)(=O)C1=CC=CC=C1SC1=CC2=C(C=C1)C(I)=NN2 |
Description and Uses
2-[(3-Iodo-1H-indazol-6-yl)sulfanyl]-N-methylbenzamide is a palladium catalyst for the synthesis of 2-[(3-iodo-1H-indazol-6-yl)sulfanyl]benzoic acid from 3,4 dinitrobenzoyl chloride and 1,2 dimethoxyethane. The reaction proceeds via a nucleophilic substitution reaction with the sulfonyl halide. The Iodo group can be replaced by other groups such as bromine, chlorine or fluorine in order to synthesize different derivatives of the compound.
Safety
| HS Code | 2933998090 |

![2-[(3-iodo-2H-indazol-6-yl)sulfanyl]-N-methylbenzamide](https://img.chemicalbook.com/CAS/GIF/885126-34-1.gif)



