PRODUCT Properties
| Melting point: | 73.0 to 77.0 °C |
| Boiling point: | 281.3±40.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Dichloromethane; Methanol |
| form | Solid |
| pka | 14+-.0.20(Predicted) |
| color | White |
| InChI | InChI=1/C8H13NO2/c1-9-5-2-4(10)3-6(9)8-7(5)11-8/h4-8,10H,2-3H2,1H3/t4-,5-,6+,7-,8+ |
| InChIKey | FIMXSEMBHGTNKT-RZVDLVGDSA-N |
| SMILES | CN1[C@@H]2C[C@@H](O)C[C@H]1[C@@H]1O[C@H]21 |&1:2,4,7,8,10,r| |
| CAS DataBase Reference | 498-45-3(CAS DataBase Reference) |
Description and Uses
Scopin is an Intermediate in the synthesis of Scopine Methobromide (Tiotropium EP Impurity G) (S199985), an impurity of Tiotropium (T444850), an muscarinic receptor antagonist and bronchodilator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| HS Code | 29349990 |




