PRODUCT Properties
| Melting point: | 258~259℃ |
| Boiling point: | 555.5±50.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 14.91±0.70(Predicted) |
| color | White to off-white |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | YOQAQNKGFOLRGT-ZIPOINFQNA-N |
| SMILES | [C@@]12(C)CC[C@@]3([H])[C@@](C)(CO)[C@@H](O)CC[C@]3(C)[C@@]1([H])CC=C1[C@]3([H])CC(C[C@@H](O)[C@]3(C)CC[C@@]21C)(C)C |&1:0,4,6,10,14,16,21,26,28,32,r| |
Description and Uses
Soyasapogenol B has been shown to attenuate lipopolysaccharide-induced memory impairment in mice.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






