M5757149
4-Nitro-1,8-naphthalicanhydride , 95% , 34087-02-0
Synonym(s):
4-Nitronaphthalene-1,8-dicarboxylic anhydride
| Pack Size | Price | Stock | Quantity |
| 1g | RMB640.00 | In Stock |
|
| 5g | RMB2000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-229 °C(lit.) |
| Boiling point: | 512.9±33.0 °C(Predicted) |
| Density | 1.637±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| Appearance | Yellow to orange Solid |
| InChI | InChI=1S/C12H5NO5/c14-11-7-3-1-2-6-4-5-8(13(16)17)10(9(6)7)12(15)18-11/h1-5H |
| InChIKey | QLYSDTXUBZEOII-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=C([N+]([O-])=O)C=CC3=C2C1=CC=C3 |
| CAS DataBase Reference | 34087-02-0(CAS DataBase Reference) |
Description and Uses
4-Nitronaphthalene-1,8-dicarboxylic anhydride is an important raw material for synthesizing dyes, pigments, reducing BG gray and fluorescent whitening agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 9-21 |
| Hazard Note | Irritant |







