PRODUCT Properties
| Melting point: | 60-80°C |
| Boiling point: | 468.68°C (rough estimate) |
| Density | d2020 1.108 |
| vapor pressure | 0.94×10-3 Pa (30 °C) |
| refractive index | nD21.5 1.5175 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in DMSO |
| form | Solid |
| Water Solubility | 1.83 mg l-1 (25 °C) |
| pka | -2.55±0.20(Predicted) |
| color | Off-white to light yellow |
| Merck | 13,9296 |
| BRN | 8807938 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | 1S/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
| InChIKey | CXBMCYHAMVGWJQ-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\C1C(C(=O)OCN2C(=O)C3=C(CCCC3)C2=O)C1(C)C |
| LogP | 4.730 |
| CAS DataBase Reference | 7696-12-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetramethrin(7696-12-0) |
| EPA Substance Registry System | Tetramethrin (7696-12-0) |
Description and Uses
Form: Colorless crystals with slight pyrethrum-like odor
Insecticide.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H331-H351-H371-H410 |
| Precautionary statements | P201-P202-P273-P301+P312-P304+P340+P311-P308+P311 |
| target organs | Nervous system |
| PPE | Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 20-50/53 |
| Safety Statements | 24/25-61-60 |
| RIDADR | UN 2588 |
| WGK Germany | 2 |
| RTECS | GZ1730000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29251900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 STOT SE 2 Inhalation |
| Hazardous Substances Data | 7696-12-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in mice: 1000 mg/kg (Kato) |
