PRODUCT Properties
| Melting point: | 190-192 °C |
| Boiling point: | 709.1±70.0 °C(Predicted) |
| Density | 2.02±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), DMF (Slightly), Methanol (Slightly, Heated), Water (Very Slightly) |
| form | Solid |
| pka | 6.81±0.20(Predicted) |
| color | Yellow to Brown |
| InChI | 1S/C10H13N5O3S/c11-10-13-8-7(9(19)14-10)12-3-15(8)6-1-4(17)5(2-16)18-6/h3-6,16-17H,1-2H2,(H3,11,13,14,19)/t4-,5-,6-/m1/s1 |
| InChIKey | SCVJRXQHFJXZFZ-HSUXUTPPSA-N |
| SMILES | S=C1C2=C(N([C@H]3C[C@H](O)[C@@H](CO)O3)C=N2)N=C(N)N1 |
Description and Uses
Guanosine (G837900) derivative with cancer chemotherapeutic properties. It is involved in the inhibition of human RNase H-mediated RNA cleavage from DNA-RNA duplexes via incorporation into DNA.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 789-61-7(Hazardous Substances Data) |
