PRODUCT Properties
| Boiling point: | 326℃ |
| alpha | D20 +82.21° (Rupe, Gassman); D22 +59.9° (c = 4.5 in hexane) (Sato) |
| Density | 0.945 |
| Flash point: | 122℃ |
| storage temp. | 2-8°C |
| solubility | Ethanol: Miscible |
| form | Liquid |
| color | Colorless to light yellow |
| InChI | InChI=1S/C15H20O/c1-11(2)9-15(16)10-13(4)14-7-5-12(3)6-8-14/h5-9,13H,10H2,1-4H3/t13-/m0/s1 |
| InChIKey | NAAJVHHFAXWBOK-ZDUSSCGKSA-N |
| SMILES | C/C(/C)=C\C(=O)C[C@@H](C1=CC=C(C)C=C1)C |
| LogP | 3.749 (est) |
Description and Uses
(+)-ar-Turmerone-d3 is the isotope labelled analog of (+)-ar-Turmerone. (+)-ar-Turmerone is an anti-tumor and immune activating agent, which maintains a cytotoxic effect in cancer cells. Antimicrobial agent.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H319-H411 |
| Precautionary statements | P273-P280-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36-43-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 29329990 |
