M6192135
THEAFLAVINE-3-GALLATE , Analysis of the control products,> 98% , 30462-34-1
| Pack Size | Price | Stock | Quantity |
| 20mg | RMB3430.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 1226.9±65.0 °C(Predicted) |
| Density | 1.93 |
| storage temp. | -20°C |
| solubility | Soluble in ethanol and methan |
| form | powder |
| pka | 6.65±0.20(Predicted) |
| color | Orange-red |
| Major Application | food and beverages |
| InChIKey | KMJPKUVSXFVQGZ-WQLSNUALSA-N |
| SMILES | C(O[C@@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1C=C(O)C(=O)C2=C(O)C(O)=CC([C@H]3OC4=CC(O)=CC(O)=C4C[C@H]3O)=C2C=1)(=O)C1=CC(O)=C(O)C(O)=C1 |
| LogP | 2.329 (est) |
Description and Uses
food and beverages
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






