PRODUCT Properties
| Melting point: | 144 °C |
| Boiling point: | 489.08°C (rough estimate) |
| Density | 1.0263 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| pka | 4.76±0.10(Predicted) |
| color | White to Pale Beige |
| Water Solubility | 682.3mg/L(25 ºC) |
| InChIKey | BHQCQFFYRZLCQQ-SURSGXJKNA-N |
| SMILES | O[C@H]1C[C@]2([H])C[C@H](O)CC[C@]2(C)[C@@]2([H])C[C@H](O)[C@@]3([C@@]([H])([C@H](C)CCC(=O)O)CC[C@@]3([H])[C@]12[H])C |&1:1,3,6,10,12,15,17,18,20,29,31,r| |
Description and Uses
Ursocholic Acid (Ursodeoxycholic Acid EP Impurity D) is an Ursodeoxycholic Acid (U850000) impurity.
