M6227635
Vinyltris(methylethylketoxime)silane , 93% , 2224-33-1
CAS NO.:2224-33-1
Empirical Formula: C14H27N3O3Si
Molecular Weight: 313.47
MDL number: MFCD00054816
EINECS: 218-747-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB36.80 | In Stock |
|
| 25g | RMB92.80 | In Stock |
|
| 100g | RMB246.40 | In Stock |
|
| 500g | RMB870.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -22°C |
| Boiling point: | 115 °C |
| Density | 0.982 |
| vapor pressure | 0.034Pa at 25℃ |
| refractive index | 1.4543-1.4553 |
| Flash point: | 90°C |
| Specific Gravity | 0.982 |
| Water Solubility | 36.63g/L |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C14H27N3O3Si/c1-8-12(5)15-18-21(11-4,19-16-13(6)9-2)20-17-14(7)10-3/h11H,4,8-10H2,1-3,5-7H3/b15-12+,16-13+,17-14+ |
| InChIKey | WXWYJCSIHQKADM-ZNAKCYKMSA-N |
| SMILES | [Si](C=C)(O/N=C(\C)/CC)(O/N=C(\C)/CC)O/N=C(\C)/CC |
| LogP | 1.69 |
| CAS DataBase Reference | 2224-33-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butanone, O,O',O''-(ethenylsilylidyne)trioxime (2224-33-1) |
Description and Uses
Vinyltris(methylethylketoxime)silane is mainly used in room temperature vulcanizing silicone rubber as a curing agent (crosslinking agent, vulcanizing agent).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H317-H315 |
| Precautionary statements | P280-P305+P351+P338-P310-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| REACH Registrations | Active |







