PRODUCT Properties
| Boiling point: | 563.4±50.0 °C(Predicted) |
| Density | 2.5583 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Colour Index | 73065 |
| pka | -7.15±0.20(Predicted) |
| form | solid |
| InChI | InChI=1S/C16H6Br4N2O2/c17-5-1-7-11(9(19)3-5)21-13(15(7)23)14-16(24)8-2-6(18)4-10(20)12(8)22-14/h1-4,21-22H |
| InChIKey | PTWYQANXSNMUTI-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2Br)C(=O)C1=C1C(=O)C2=C(N1)C(Br)=CC(Br)=C2 |
| CAS DataBase Reference | 2475-31-2(CAS DataBase Reference) |
| NIST Chemistry Reference | c.i. Vat blue 5(2475-31-2) |
| EPA Substance Registry System | 3H-Indol-3-one, 5,7-dibromo-2-(5,7-dibromo-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- (2475-31-2) |
Description and Uses
Ciba Blue 2B (CAS# 2475-31-2) is a halogenated indigo dye and pollutant contributing 1,3,6,8-tetrabromocarbazole and some other halogenated carbazoles to the environment.
Safety
| RTECS | NM3259100 |



