PRODUCT Properties
| Melting point: | 293°C |
| Boiling point: | 577.2±50.0 °C(Predicted) |
| Density | 1.436 g/cm3 |
| pka | 0.78±0.59(Predicted) |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| InChI | InChI=1S/C18H18N4O6/c1-11(23)17(18(24)19-13-6-4-5-7-15(13)27-2)21-20-14-9-8-12(22(25)26)10-16(14)28-3/h4-10,17H,1-3H3,(H,19,24) |
| InChIKey | ZTISORAUJJGACZ-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC=C1OC)(=O)C(N=NC1=CC=C([N+]([O-])=O)C=C1OC)C(=O)C |
| CAS DataBase Reference | 6358-31-2(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Pigment Yellow 74 (6358-31-2) |
Description and Uses
Pigment Yellow 74's color paste is between Pigment Yellow 1 and Pigment Yellow 3, and its tinting strength is higher than any other monoazo pigment yellow. It is mainly used in the printing ink and coating industry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Hazardous Substances Data | 6358-31-2(Hazardous Substances Data) |
| REACH Registrations | Active |





![3,6-Bis(4-chlorophenyl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione](https://img.chemicalbook.com/CAS/GIF/84632-65-5.gif)
